C15H22F4O — CID 144809541
2-methyl-5-(4,4,5,5-tetrafluoro-6-methyl-3-methylidenehept-6-enyl)oxane (PubChem CID 144809541) has the molecular formula C15H22F4O and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-methyl-5-(4,4,5,5-tetrafluoro-6-methyl-3-methylidenehept-6-enyl)oxane.
| Compound Name | 2-methyl-5-(4,4,5,5-tetrafluoro-6-methyl-3-methylidenehept-6-enyl)oxane |
|---|---|
| PubChem CID | 144809541 |
| Molecular Formula | C15H22F4O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-methyl-5-(4,4,5,5-tetrafluoro-6-methyl-3-methylidenehept-6-enyl)oxane |
| SMILES | C=C(C)C(F)(F)C(F)(F)C(=C)CCC1CCC(C)OC1 |
| InChI | InChI=1S/C15H22F4O/c1-10(2)14(16,17)15(18,19)11(3)5-7-13-8-6-12(4)20-9-13/h12-13H,1,3,5-9H2,2,4H3 |
| InChIKey | HLCHMWLHMJQNLS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|