C26H38F6O2 — CID 144809581
5-[difluoro-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)oxymethyl]-2-[4-(4-methylcyclohexyl)cyclohexyl]oxane (PubChem CID 144809581) has the molecular formula C26H38F6O2 and a molecular weight of 496.58 g/mol. Its IUPAC name is 5-[difluoro-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)oxymethyl]-2-[4-(4-methylcyclohexyl)cyclohexyl]oxane.
| Compound Name | 5-[difluoro-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)oxymethyl]-2-[4-(4-methylcyclohexyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 144809581 |
| Molecular Formula | C26H38F6O2 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 5-[difluoro-(3,3,4,4-tetrafluoro-5-methylhexa-1,5-dien-2-yl)oxymethyl]-2-[4-(4-methylcyclohexyl)cyclohexyl]oxane |
| SMILES | C=C(C)C(F)(F)C(F)(F)C(=C)OC(F)(F)C1CCC(C2CCC(C3CCC(C)CC3)CC2)OC1 |
| InChI | InChI=1S/C26H38F6O2/c1-16(2)24(27,28)25(29,30)18(4)34-26(31,32)22-13-14-23(33-15-22)21-11-9-20(10-12-21)19-7-5-17(3)6-8-19/h17,19-23H,1,4-15H2,2-3H3 |
| InChIKey | AOMWDYIITSTJOU-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|