C19H30BrF3O2 — CID 142900009
2-[4-[(4-bromo-3-fluorocyclohexyl)oxy-difluoromethyl]cyclohexyl]-5-methyloxane (PubChem CID 142900009) has the molecular formula C19H30BrF3O2 and a molecular weight of 427.35 g/mol. Its IUPAC name is 2-[4-[(4-bromo-3-fluorocyclohexyl)oxy-difluoromethyl]cyclohexyl]-5-methyloxane.
| Compound Name | 2-[4-[(4-bromo-3-fluorocyclohexyl)oxy-difluoromethyl]cyclohexyl]-5-methyloxane |
|---|---|
| PubChem CID | 142900009 |
| Molecular Formula | C19H30BrF3O2 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-[4-[(4-bromo-3-fluorocyclohexyl)oxy-difluoromethyl]cyclohexyl]-5-methyloxane |
| SMILES | CC1CCC(C2CCC(C(F)(F)OC3CCC(Br)C(F)C3)CC2)OC1 |
| InChI | InChI=1S/C19H30BrF3O2/c1-12-2-9-18(24-11-12)13-3-5-14(6-4-13)19(22,23)25-15-7-8-16(20)17(21)10-15/h12-18H,2-11H2,1H3 |
| InChIKey | XAPNTIWOPKJVAQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|