C23H40F2O — CID 59938742
1-[difluoro-(4-methylcyclohexyl)oxymethyl]-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane (PubChem CID 59938742) has the molecular formula C23H40F2O and a molecular weight of 370.57 g/mol. Its IUPAC name is 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane.
| Compound Name | 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane |
|---|---|
| PubChem CID | 59938742 |
| Molecular Formula | C23H40F2O |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | 1-[difluoro-(4-methylcyclohexyl)oxymethyl]-4-[2-(4-methylcyclohexyl)ethyl]cyclohexane |
| SMILES | CC1CCC(CCC2CCC(C(F)(F)OC3CCC(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H40F2O/c1-17-3-7-19(8-4-17)9-10-20-11-13-21(14-12-20)23(24,25)26-22-15-5-18(2)6-16-22/h17-22H,3-16H2,1-2H3 |
| InChIKey | QQHIXMGMCJHIGW-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |