C14H24F2O — CID 142035391
1-[cyclohexyloxy(difluoro)methyl]-4-methylcyclohexane (PubChem CID 142035391) has the molecular formula C14H24F2O and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-[cyclohexyloxy(difluoro)methyl]-4-methylcyclohexane.
| Compound Name | 1-[cyclohexyloxy(difluoro)methyl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 142035391 |
| Molecular Formula | C14H24F2O |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-[cyclohexyloxy(difluoro)methyl]-4-methylcyclohexane |
| SMILES | CC1CCC(C(F)(F)OC2CCCCC2)CC1 |
| InChI | InChI=1S/C14H24F2O/c1-11-7-9-12(10-8-11)14(15,16)17-13-5-3-2-4-6-13/h11-13H,2-10H2,1H3 |
| InChIKey | NMDNHXVDZFZRRJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |