About 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane
1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane (PubChem CID 144642715) has the molecular formula C23H40F2O
and a molecular weight of 370.57 g/mol. Its IUPAC name is 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane.
Molecular Properties
| Compound Name | 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane |
| PubChem CID | 144642715 |
| Molecular Formula | C23H40F2O |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane |
| SMILES | CC1CCC(C2CCC(C(F)(F)OC3CCC(C)C(C)C3C)CC2)CC1 |
| InChI | InChI=1S/C23H40F2O/c1-15-5-8-19(9-6-15)20-10-12-21(13-11-20)23(24,25)26-22-14-7-16(2)17(3)18(22)4/h15-22H,5-14H2,1-4H3 |
| InChIKey | DCALGLMWTYTPEC-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane?
The IUPAC name of 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane (CID 144642715) is 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane.
What is the SMILES notation for 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane?
The canonical SMILES for 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane is CC1CCC(C2CCC(C(F)(F)OC3CCC(C)C(C)C3C)CC2)CC1.
What is the InChIKey of 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane?
The InChIKey is DCALGLMWTYTPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40F2O/c1-15-5-8-19(9-6-15)20-10-12-21(13-11-20)23(24,25)26-22-14-7-16(2)17(3)18(22)4/h15-22H,5-14H2,1-4H3.
What are the key properties of 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane?
1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane has a molecular weight of 370.57 g/mol, XLogP of 7.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,3,4-trimethylcyclohexane is sourced from PubChem (CID 144642715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).