C19H34F2O2 — CID 137428561
1-butoxy-4-[difluoro-(4-methylcyclohexyl)methoxy]-2-methylcyclohexane (PubChem CID 137428561) has the molecular formula C19H34F2O2 and a molecular weight of 332.48 g/mol. Its IUPAC name is 1-butoxy-4-[difluoro-(4-methylcyclohexyl)methoxy]-2-methylcyclohexane.
| Compound Name | 1-butoxy-4-[difluoro-(4-methylcyclohexyl)methoxy]-2-methylcyclohexane |
|---|---|
| PubChem CID | 137428561 |
| Molecular Formula | C19H34F2O2 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1-butoxy-4-[difluoro-(4-methylcyclohexyl)methoxy]-2-methylcyclohexane |
| SMILES | CCCCOC1CCC(OC(F)(F)C2CCC(C)CC2)CC1C |
| InChI | InChI=1S/C19H34F2O2/c1-4-5-12-22-18-11-10-17(13-15(18)3)23-19(20,21)16-8-6-14(2)7-9-16/h14-18H,4-13H2,1-3H3 |
| InChIKey | DESHUBPEVMKJLT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|