About ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate
ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate (PubChem CID 144811318) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate.
Analyze ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate?
The IUPAC name of ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate (CID 144811318) is ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate.
What is the SMILES notation for ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate?
The canonical SMILES for ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate is CC.COC(=O)c1[nH]cc2c1CCCC2.
What is the InChIKey of ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate?
The InChIKey is QKUXMZHEAXOYKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C2H6/c1-13-10(12)9-8-5-3-2-4-7(8)6-11-9;1-2/h6,11H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate?
ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate has a molecular weight of 209.29 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 4,5,6,7-tetrahydro-2H-isoindole-1-carboxylate is sourced from PubChem (CID 144811318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).