C11H7ClN2O2S — CID 144811588
2-[6-(5-chlorothiophen-2-yl)-3-pyridinyl]-2-oxoacetamide (PubChem CID 144811588) has the molecular formula C11H7ClN2O2S and a molecular weight of 266.71 g/mol. Its IUPAC name is 2-[6-(5-chlorothiophen-2-yl)-3-pyridinyl]-2-oxoacetamide.
| Compound Name | 2-[6-(5-chlorothiophen-2-yl)-3-pyridinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 144811588 |
| Molecular Formula | C11H7ClN2O2S |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 2-[6-(5-chlorothiophen-2-yl)-3-pyridinyl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1ccc(-c2ccc(Cl)s2)nc1 |
| InChI | InChI=1S/C11H7ClN2O2S/c12-9-4-3-8(17-9)7-2-1-6(5-14-7)10(15)11(13)16/h1-5H,(H2,13,16) |
| InChIKey | BEZFSSULBSOFKH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|