C10H19F2NO2 — CID 144812819
5,5-difluoro-3,3-dimethylpiperidine-2-carboxylic acid;ethane (PubChem CID 144812819) has the molecular formula C10H19F2NO2 and a molecular weight of 223.26 g/mol. Its IUPAC name is 5,5-difluoro-3,3-dimethylpiperidine-2-carboxylic acid;ethane.
| Compound Name | 5,5-difluoro-3,3-dimethylpiperidine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 144812819 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 5,5-difluoro-3,3-dimethylpiperidine-2-carboxylic acid;ethane |
| SMILES | CC.CC1(C)CC(F)(F)CNC1C(=O)O |
| InChI | InChI=1S/C8H13F2NO2.C2H6/c1-7(2)3-8(9,10)4-11-5(7)6(12)13;1-2/h5,11H,3-4H2,1-2H3,(H,12,13);1-2H3 |
| InChIKey | FYOHKIQTGJUMKY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |