C32H35N3 — CID 144813865
4-[bis[4-(dimethylamino)phenyl]methyl]-N-[(4-ethenylphenyl)methyl]aniline (PubChem CID 144813865) has the molecular formula C32H35N3 and a molecular weight of 461.65 g/mol. Its IUPAC name is 4-[bis[4-(dimethylamino)phenyl]methyl]-N-[(4-ethenylphenyl)methyl]aniline.
| Compound Name | 4-[bis[4-(dimethylamino)phenyl]methyl]-N-[(4-ethenylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 144813865 |
| Molecular Formula | C32H35N3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 4-[bis[4-(dimethylamino)phenyl]methyl]-N-[(4-ethenylphenyl)methyl]aniline |
| SMILES | C=Cc1ccc(CNc2ccc(C(c3ccc(N(C)C)cc3)c3ccc(N(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H35N3/c1-6-24-7-9-25(10-8-24)23-33-29-17-11-26(12-18-29)32(27-13-19-30(20-14-27)34(2)3)28-15-21-31(22-16-28)35(4)5/h6-22,32-33H,1,23H2,2-5H3 |
| InChIKey | BYNSSLOHATZWIS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|