C33H27NS — CID 144816090
4-(3-dibenzothiophen-2-ylphenyl)-2-[(1Z,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]aniline (PubChem CID 144816090) has the molecular formula C33H27NS and a molecular weight of 469.65 g/mol. Its IUPAC name is 4-(3-dibenzothiophen-2-ylphenyl)-2-[(1Z,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]aniline.
| Compound Name | 4-(3-dibenzothiophen-2-ylphenyl)-2-[(1Z,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]aniline |
|---|---|
| PubChem CID | 144816090 |
| Molecular Formula | C33H27NS |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-(3-dibenzothiophen-2-ylphenyl)-2-[(1Z,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]aniline |
| SMILES | C=C/C=C\C=C(C)\C=C/c1cc(-c2cccc(-c3ccc4sc5ccccc5c4c3)c2)ccc1N |
| InChI | InChI=1S/C33H27NS/c1-3-4-5-9-23(2)14-15-28-21-26(16-18-31(28)34)24-10-8-11-25(20-24)27-17-19-33-30(22-27)29-12-6-7-13-32(29)35-33/h3-22H,1,34H2,2H3/b5-4-,15-14-,23-9+ |
| InChIKey | BTCFMUWHSGJMGE-JJQFOEDKSA-N |
| XLogP | 9.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|