C41H40N2O — CID 144816082
4-dibenzofuran-2-yl-2-[(1Z,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]aniline;N-methylaniline;toluene (PubChem CID 144816082) has the molecular formula C41H40N2O and a molecular weight of 576.78 g/mol. Its IUPAC name is 4-dibenzofuran-2-yl-2-[(1Z,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]aniline;N-methylaniline;toluene.
| Compound Name | 4-dibenzofuran-2-yl-2-[(1Z,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]aniline;N-methylaniline;toluene |
|---|---|
| PubChem CID | 144816082 |
| Molecular Formula | C41H40N2O |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 4-dibenzofuran-2-yl-2-[(1Z,3E,5Z)-3-methylocta-1,3,5,7-tetraenyl]aniline;N-methylaniline;toluene |
| SMILES | C=C/C=C\C=C(C)\C=C/c1cc(-c2ccc3oc4ccccc4c3c2)ccc1N.CNc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C27H23NO.C7H9N.C7H8/c1-3-4-5-8-19(2)11-12-22-17-20(13-15-25(22)28)21-14-16-27-24(18-21)23-9-6-7-10-26(23)29-27;1-8-7-5-3-2-4-6-7;1-7-5-3-2-4-6-7/h3-18H,1,28H2,2H3;2-6,8H,1H3;2-6H,1H3/b5-4-,12-11-,19-8+;; |
| InChIKey | WFNHBYXMRXAGED-AAEDGANMSA-N |
| XLogP | 11.26 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|