C59H40N2O — CID 146254749
2-[4-[9-[(1Z)-buta-1,3-dienyl]-10-methylphenanthren-2-yl]phenyl]-4-[4-(4-dibenzofuran-2-ylphenyl)phenyl]-6-phenylpyrimidine (PubChem CID 146254749) has the molecular formula C59H40N2O and a molecular weight of 792.98 g/mol. Its IUPAC name is 2-[4-[9-[(1Z)-buta-1,3-dienyl]-10-methylphenanthren-2-yl]phenyl]-4-[4-(4-dibenzofuran-2-ylphenyl)phenyl]-6-phenylpyrimidine.
| Compound Name | 2-[4-[9-[(1Z)-buta-1,3-dienyl]-10-methylphenanthren-2-yl]phenyl]-4-[4-(4-dibenzofuran-2-ylphenyl)phenyl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 146254749 |
| Molecular Formula | C59H40N2O |
| Molecular Weight | 792.98 g/mol |
| Exact Mass | 792.31 |
| IUPAC Name | 2-[4-[9-[(1Z)-buta-1,3-dienyl]-10-methylphenanthren-2-yl]phenyl]-4-[4-(4-dibenzofuran-2-ylphenyl)phenyl]-6-phenylpyrimidine |
| SMILES | C=C/C=C\c1c(C)c2cc(-c3ccc(-c4nc(-c5ccccc5)cc(-c5ccc(-c6ccc(-c7ccc8oc9ccccc9c8c7)cc6)cc5)n4)cc3)ccc2c2ccccc12 |
| InChI | InChI=1S/C59H40N2O/c1-3-4-14-48-38(2)53-35-46(31-33-51(53)50-16-9-8-15-49(48)50)42-25-29-45(30-26-42)59-60-55(43-12-6-5-7-13-43)37-56(61-59)44-27-23-40(24-28-44)39-19-21-41(22-20-39)47-32-34-58-54(36-47)52-17-10-11-18-57(52)62-58/h3-37H,1H2,2H3/b14-4- |
| InChIKey | ANOSTDRUSYYUFJ-CPSFFCFKSA-N |
| XLogP | 16.19 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.98 |
| LogP ≤ 5 | 16.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|