C30H24N2O — CID 145448341
3-N-dibenzofuran-2-yl-1-N-[(3Z)-hexa-1,3,5-trien-2-yl]-3-N-phenylbenzene-1,3-diamine (PubChem CID 145448341) has the molecular formula C30H24N2O and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-N-dibenzofuran-2-yl-1-N-[(3Z)-hexa-1,3,5-trien-2-yl]-3-N-phenylbenzene-1,3-diamine.
| Compound Name | 3-N-dibenzofuran-2-yl-1-N-[(3Z)-hexa-1,3,5-trien-2-yl]-3-N-phenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 145448341 |
| Molecular Formula | C30H24N2O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-N-dibenzofuran-2-yl-1-N-[(3Z)-hexa-1,3,5-trien-2-yl]-3-N-phenylbenzene-1,3-diamine |
| SMILES | C=C/C=C\C(=C)Nc1cccc(N(c2ccccc2)c2ccc3oc4ccccc4c3c2)c1 |
| InChI | InChI=1S/C30H24N2O/c1-3-4-11-22(2)31-23-12-10-15-25(20-23)32(24-13-6-5-7-14-24)26-18-19-30-28(21-26)27-16-8-9-17-29(27)33-30/h3-21,31H,1-2H2/b11-4- |
| InChIKey | CLLWPPQPVIWDMK-WCIBSUBMSA-N |
| XLogP | 8.72 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|