C48H37NO — CID 145067471
N-[4-[5-[(3Z)-hexa-1,3,5-trien-2-yl]cyclohexa-1,5-dien-1-yl]phenyl]-N-[4-(3-phenylphenyl)phenyl]dibenzofuran-2-amine (PubChem CID 145067471) has the molecular formula C48H37NO and a molecular weight of 643.83 g/mol. Its IUPAC name is N-[4-[5-[(3Z)-hexa-1,3,5-trien-2-yl]cyclohexa-1,5-dien-1-yl]phenyl]-N-[4-(3-phenylphenyl)phenyl]dibenzofuran-2-amine.
| Compound Name | N-[4-[5-[(3Z)-hexa-1,3,5-trien-2-yl]cyclohexa-1,5-dien-1-yl]phenyl]-N-[4-(3-phenylphenyl)phenyl]dibenzofuran-2-amine |
|---|---|
| PubChem CID | 145067471 |
| Molecular Formula | C48H37NO |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | N-[4-[5-[(3Z)-hexa-1,3,5-trien-2-yl]cyclohexa-1,5-dien-1-yl]phenyl]-N-[4-(3-phenylphenyl)phenyl]dibenzofuran-2-amine |
| SMILES | C=C/C=C\C(=C)C1=CC(c2ccc(N(c3ccc(-c4cccc(-c5ccccc5)c4)cc3)c3ccc4oc5ccccc5c4c3)cc2)=CCC1 |
| InChI | InChI=1S/C48H37NO/c1-3-4-12-34(2)38-15-10-16-39(31-38)36-21-25-42(26-22-36)49(44-29-30-48-46(33-44)45-19-8-9-20-47(45)50-48)43-27-23-37(24-28-43)41-18-11-17-40(32-41)35-13-6-5-7-14-35/h3-9,11-14,16-33H,1-2,10,15H2/b12-4- |
| InChIKey | UVJAFHQQUCIPPM-QCDXTXTGSA-N |
| XLogP | 13.79 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|