C45H34N4S — CID 144816202
(3,5-diphenylphenyl)-[4-(methylideneamino)thiophen-3-yl]methanimine;10-methyl-3-phenylpyrrolo[3,2-a]carbazole (PubChem CID 144816202) has the molecular formula C45H34N4S and a molecular weight of 662.86 g/mol. Its IUPAC name is (3,5-diphenylphenyl)-[4-(methylideneamino)thiophen-3-yl]methanimine;10-methyl-3-phenylpyrrolo[3,2-a]carbazole.
| Compound Name | (3,5-diphenylphenyl)-[4-(methylideneamino)thiophen-3-yl]methanimine;10-methyl-3-phenylpyrrolo[3,2-a]carbazole |
|---|---|
| PubChem CID | 144816202 |
| Molecular Formula | C45H34N4S |
| Molecular Weight | 662.86 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | (3,5-diphenylphenyl)-[4-(methylideneamino)thiophen-3-yl]methanimine;10-methyl-3-phenylpyrrolo[3,2-a]carbazole |
| SMILES | Cn1c2ccccc2c2ccc3c(ccn3-c3ccccc3)c21.[H]/N=C(\c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1cscc1N=C |
| InChI | InChI=1S/C24H18N2S.C21H16N2/c1-26-23-16-27-15-22(23)24(25)21-13-19(17-8-4-2-5-9-17)12-20(14-21)18-10-6-3-7-11-18;1-22-19-10-6-5-9-16(19)17-11-12-20-18(21(17)22)13-14-23(20)15-7-3-2-4-8-15/h2-16,25H,1H2;2-14H,1H3/b25-24+; |
| InChIKey | ABWOGUBJHHJAAW-QREUMGABSA-N |
| XLogP | 12.11 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.86 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|