C39H30N4S — CID 144816286
[3-(methylideneamino)thiophen-2-yl]-(4-phenylphenyl)methanimine;10-methyl-3-phenylpyrrolo[3,2-a]carbazole (PubChem CID 144816286) has the molecular formula C39H30N4S and a molecular weight of 586.76 g/mol. Its IUPAC name is [3-(methylideneamino)thiophen-2-yl]-(4-phenylphenyl)methanimine;10-methyl-3-phenylpyrrolo[3,2-a]carbazole.
| Compound Name | [3-(methylideneamino)thiophen-2-yl]-(4-phenylphenyl)methanimine;10-methyl-3-phenylpyrrolo[3,2-a]carbazole |
|---|---|
| PubChem CID | 144816286 |
| Molecular Formula | C39H30N4S |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | [3-(methylideneamino)thiophen-2-yl]-(4-phenylphenyl)methanimine;10-methyl-3-phenylpyrrolo[3,2-a]carbazole |
| SMILES | Cn1c2ccccc2c2ccc3c(ccn3-c3ccccc3)c21.[H]/N=C(\c1ccc(-c2ccccc2)cc1)c1sccc1N=C |
| InChI | InChI=1S/C21H16N2.C18H14N2S/c1-22-19-10-6-5-9-16(19)17-11-12-20-18(21(17)22)13-14-23(20)15-7-3-2-4-8-15;1-20-16-11-12-21-18(16)17(19)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-14H,1H3;2-12,19H,1H2/b;19-17+ |
| InChIKey | XXBQTDWMNNZNNI-YFEKSWFOSA-N |
| XLogP | 10.44 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|