C20H21F3N4O — CID 144817254
1-methylpiperidine;5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbaldehyde (PubChem CID 144817254) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is 1-methylpiperidine;5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbaldehyde.
| Compound Name | 1-methylpiperidine;5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 144817254 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-methylpiperidine;5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbaldehyde |
| SMILES | CN1CCCCC1.O=Cc1cc2nc(-c3ccccc3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C14H8F3N3O.C6H13N/c15-14(16,17)12-7-11(9-4-2-1-3-5-9)18-13-6-10(8-21)19-20(12)13;1-7-5-3-2-4-6-7/h1-8H;2-6H2,1H3 |
| InChIKey | OFNQKTJZOMTYGN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|