C19H10F13N3 — CID 17132278
2-methyl-5-phenyl-7-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 17132278) has the molecular formula C19H10F13N3 and a molecular weight of 527.28 g/mol. Its IUPAC name is 2-methyl-5-phenyl-7-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-methyl-5-phenyl-7-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 17132278 |
| Molecular Formula | C19H10F13N3 |
| Molecular Weight | 527.28 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 2-methyl-5-phenyl-7-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc2nc(-c3ccccc3)cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n2n1 |
| InChI | InChI=1S/C19H10F13N3/c1-9-7-13-33-11(10-5-3-2-4-6-10)8-12(35(13)34-9)14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h2-8H,1H3 |
| InChIKey | SVVDGGCTHZQHKG-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.28 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|