C15H14BrNO — CID 144819173
4-bromo-2-(3-methoxyphenyl)-1,3-dihydroisoindole (PubChem CID 144819173) has the molecular formula C15H14BrNO and a molecular weight of 304.19 g/mol. Its IUPAC name is 4-bromo-2-(3-methoxyphenyl)-1,3-dihydroisoindole.
| Compound Name | 4-bromo-2-(3-methoxyphenyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 144819173 |
| Molecular Formula | C15H14BrNO |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 4-bromo-2-(3-methoxyphenyl)-1,3-dihydroisoindole |
| SMILES | COc1cccc(N2Cc3cccc(Br)c3C2)c1 |
| InChI | InChI=1S/C15H14BrNO/c1-18-13-6-3-5-12(8-13)17-9-11-4-2-7-15(16)14(11)10-17/h2-8H,9-10H2,1H3 |
| InChIKey | DFMNKKNWTAIFDU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |