C27H40N4O2S — CID 144819854
N-[1-[4-[[1-cyclobutylidene-5-(ethenylamino)pentyl]amino]phenyl]-3-hydroxybut-3-en-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 144819854) has the molecular formula C27H40N4O2S and a molecular weight of 484.71 g/mol. Its IUPAC name is N-[1-[4-[[1-cyclobutylidene-5-(ethenylamino)pentyl]amino]phenyl]-3-hydroxybut-3-en-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[1-[4-[[1-cyclobutylidene-5-(ethenylamino)pentyl]amino]phenyl]-3-hydroxybut-3-en-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 144819854 |
| Molecular Formula | C27H40N4O2S |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | N-[1-[4-[[1-cyclobutylidene-5-(ethenylamino)pentyl]amino]phenyl]-3-hydroxybut-3-en-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | C=CNCCCCC(Nc1ccc(CC(NC(=O)C2NCSC2(C)C)C(=C)O)cc1)=C1CCC1 |
| InChI | InChI=1S/C27H40N4O2S/c1-5-28-16-7-6-11-23(21-9-8-10-21)30-22-14-12-20(13-15-22)17-24(19(2)32)31-26(33)25-27(3,4)34-18-29-25/h5,12-15,24-25,28-30,32H,1-2,6-11,16-18H2,3-4H3,(H,31,33) |
| InChIKey | XFKDBNJFWJTXKH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|