C13H18N2 — CID 144820001
N-methyl-4-[2-(methylamino)penta-3,4-dienyl]aniline (PubChem CID 144820001) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-methyl-4-[2-(methylamino)penta-3,4-dienyl]aniline.
| Compound Name | N-methyl-4-[2-(methylamino)penta-3,4-dienyl]aniline |
|---|---|
| PubChem CID | 144820001 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-methyl-4-[2-(methylamino)penta-3,4-dienyl]aniline |
| SMILES | C=C=CC(Cc1ccc(NC)cc1)NC |
| InChI | InChI=1S/C13H18N2/c1-4-5-13(15-3)10-11-6-8-12(14-2)9-7-11/h5-9,13-15H,1,10H2,2-3H3 |
| InChIKey | FJFHHFFKUZSMPL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |