C27H28ClN3O3 — CID 144820449
15-(2-chlorophenyl)-4-[(2-methoxyphenyl)methyl]-4,8,15-triazatricyclo[9.5.0.02,8]hexadeca-1,10-diene-9,16-dione (PubChem CID 144820449) has the molecular formula C27H28ClN3O3 and a molecular weight of 477.99 g/mol. Its IUPAC name is 15-(2-chlorophenyl)-4-[(2-methoxyphenyl)methyl]-4,8,15-triazatricyclo[9.5.0.02,8]hexadeca-1,10-diene-9,16-dione.
| Compound Name | 15-(2-chlorophenyl)-4-[(2-methoxyphenyl)methyl]-4,8,15-triazatricyclo[9.5.0.02,8]hexadeca-1,10-diene-9,16-dione |
|---|---|
| PubChem CID | 144820449 |
| Molecular Formula | C27H28ClN3O3 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 15-(2-chlorophenyl)-4-[(2-methoxyphenyl)methyl]-4,8,15-triazatricyclo[9.5.0.02,8]hexadeca-1,10-diene-9,16-dione |
| SMILES | COc1ccccc1CN1CCCn2c(c3c(cc2=O)CCCN(c2ccccc2Cl)C3=O)C1 |
| InChI | InChI=1S/C27H28ClN3O3/c1-34-24-12-5-2-8-20(24)17-29-13-7-15-30-23(18-29)26-19(16-25(30)32)9-6-14-31(27(26)33)22-11-4-3-10-21(22)28/h2-5,8,10-12,16H,6-7,9,13-15,17-18H2,1H3 |
| InChIKey | CEFUJPZXBVGGBL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |