About 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine
1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine (PubChem CID 144821755) has the molecular formula C17H34N2
and a molecular weight of 266.47 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine.
Molecular Properties
| Compound Name | 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine |
| PubChem CID | 144821755 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine |
| SMILES | C1=C(N2CCCC2)CCCC1.C1CCNC1.CCC |
| InChI | InChI=1S/C10H17N.C4H9N.C3H8/c1-2-6-10(7-3-1)11-8-4-5-9-11;1-2-4-5-3-1;1-3-2/h6H,1-5,7-9H2;5H,1-4H2;3H2,1-2H3 |
| InChIKey | DAZHPODLSYXHKB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine?
The IUPAC name of 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine (CID 144821755) is 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine.
What is the SMILES notation for 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine?
The canonical SMILES for 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine is C1=C(N2CCCC2)CCCC1.C1CCNC1.CCC.
What is the InChIKey of 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine?
The InChIKey is DAZHPODLSYXHKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.C4H9N.C3H8/c1-2-6-10(7-3-1)11-8-4-5-9-11;1-2-4-5-3-1;1-3-2/h6H,1-5,7-9H2;5H,1-4H2;3H2,1-2H3.
What are the key properties of 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine?
1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine has a molecular weight of 266.47 g/mol, XLogP of 4.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexen-1-yl)pyrrolidine;propane;pyrrolidine is sourced from PubChem (CID 144821755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).