C21H18Cl2N2O3S — CID 144822910
4-[6-(3,5-dichlorophenoxy)-5-methyl-3-pyridinyl]-3-methoxy-N-methylsulfanylbenzamide (PubChem CID 144822910) has the molecular formula C21H18Cl2N2O3S and a molecular weight of 449.36 g/mol. Its IUPAC name is 4-[6-(3,5-dichlorophenoxy)-5-methyl-3-pyridinyl]-3-methoxy-N-methylsulfanylbenzamide.
| Compound Name | 4-[6-(3,5-dichlorophenoxy)-5-methyl-3-pyridinyl]-3-methoxy-N-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 144822910 |
| Molecular Formula | C21H18Cl2N2O3S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 4-[6-(3,5-dichlorophenoxy)-5-methyl-3-pyridinyl]-3-methoxy-N-methylsulfanylbenzamide |
| SMILES | COc1cc(C(=O)NSC)ccc1-c1cnc(Oc2cc(Cl)cc(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C21H18Cl2N2O3S/c1-12-6-14(11-24-21(12)28-17-9-15(22)8-16(23)10-17)18-5-4-13(7-19(18)27-2)20(26)25-29-3/h4-11H,1-3H3,(H,25,26) |
| InChIKey | DKFKRORYUCCZGM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|