C19H21ClN2O5S — CID 122422546
4-(5-chloro-6-cyclobutyloxy-3-pyridinyl)-N-ethylsulfonyl-3-methoxybenzamide (PubChem CID 122422546) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is 4-(5-chloro-6-cyclobutyloxy-3-pyridinyl)-N-ethylsulfonyl-3-methoxybenzamide.
| Compound Name | 4-(5-chloro-6-cyclobutyloxy-3-pyridinyl)-N-ethylsulfonyl-3-methoxybenzamide |
|---|---|
| PubChem CID | 122422546 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 4-(5-chloro-6-cyclobutyloxy-3-pyridinyl)-N-ethylsulfonyl-3-methoxybenzamide |
| SMILES | CCS(=O)(=O)NC(=O)c1ccc(-c2cnc(OC3CCC3)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C19H21ClN2O5S/c1-3-28(24,25)22-18(23)12-7-8-15(17(10-12)26-2)13-9-16(20)19(21-11-13)27-14-5-4-6-14/h7-11,14H,3-6H2,1-2H3,(H,22,23) |
| InChIKey | RXOSVEJXXCYCCO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |