C26H27N7O4 — CID 144823910
1-(1-benzoyl-1,6-diazaspiro[2.5]octan-6-yl)-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione;molecular hydrogen (PubChem CID 144823910) has the molecular formula C26H27N7O4 and a molecular weight of 501.55 g/mol. Its IUPAC name is 1-(1-benzoyl-1,6-diazaspiro[2.5]octan-6-yl)-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione;molecular hydrogen.
| Compound Name | 1-(1-benzoyl-1,6-diazaspiro[2.5]octan-6-yl)-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione;molecular hydrogen |
|---|---|
| PubChem CID | 144823910 |
| Molecular Formula | C26H27N7O4 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 1-(1-benzoyl-1,6-diazaspiro[2.5]octan-6-yl)-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione;molecular hydrogen |
| SMILES | COc1cnc(-n2cnc(C)n2)c2[nH]cc(C(=O)C(=O)N3CCC4(CC3)CN4C(=O)c3ccccc3)c12.[H][H] |
| InChI | InChI=1S/C26H25N7O4.H2/c1-16-29-15-33(30-16)23-21-20(19(37-2)13-28-23)18(12-27-21)22(34)25(36)31-10-8-26(9-11-31)14-32(26)24(35)17-6-4-3-5-7-17;/h3-7,12-13,15,27H,8-11,14H2,1-2H3;1H |
| InChIKey | WQCDOBBUNIKQSQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 126.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|