C32H38N10O8 — CID 146231455
1-[7-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-1,2,4-triazol-1-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 146231455) has the molecular formula C32H38N10O8 and a molecular weight of 690.72 g/mol. Its IUPAC name is 1-[7-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-1,2,4-triazol-1-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[7-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-1,2,4-triazol-1-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 146231455 |
| Molecular Formula | C32H38N10O8 |
| Molecular Weight | 690.72 g/mol |
| Exact Mass | 690.29 |
| IUPAC Name | 1-[7-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxymethyl]-1,2,4-triazol-1-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(COCCOCCOCCOCCN=[N+]=[N-])n2)c2[nH]cc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C32H38N10O8/c1-46-25-20-35-30(42-22-36-26(38-42)21-50-18-17-49-16-15-48-14-13-47-12-7-37-39-33)28-27(25)24(19-34-28)29(43)32(45)41-10-8-40(9-11-41)31(44)23-5-3-2-4-6-23/h2-6,19-20,22,34H,7-18,21H2,1H3 |
| InChIKey | JJBZJALJGHOUMJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 211.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.72 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|