C25H23N5O — CID 144828629
N-[4-(1-azabicyclo[4.1.0]hepta-2,4-dien-3-yl)phenyl]-2-(5-methoxy-1,3-dihydroisoindol-2-yl)pyrimidin-4-amine (PubChem CID 144828629) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[4-(1-azabicyclo[4.1.0]hepta-2,4-dien-3-yl)phenyl]-2-(5-methoxy-1,3-dihydroisoindol-2-yl)pyrimidin-4-amine.
| Compound Name | N-[4-(1-azabicyclo[4.1.0]hepta-2,4-dien-3-yl)phenyl]-2-(5-methoxy-1,3-dihydroisoindol-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 144828629 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[4-(1-azabicyclo[4.1.0]hepta-2,4-dien-3-yl)phenyl]-2-(5-methoxy-1,3-dihydroisoindol-2-yl)pyrimidin-4-amine |
| SMILES | COc1ccc2c(c1)CN(c1nccc(Nc3ccc(C4=CN5CC5C=C4)cc3)n1)C2 |
| InChI | InChI=1S/C25H23N5O/c1-31-23-9-5-19-14-30(15-20(19)12-23)25-26-11-10-24(28-25)27-21-6-2-17(3-7-21)18-4-8-22-16-29(22)13-18/h2-13,22H,14-16H2,1H3,(H,26,27,28) |
| InChIKey | ZHBNKONNIVWUSZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|