C25H21F4N5O — CID 144829254
2-[4-[8-fluoro-6-methyl-7-[2-(trifluoromethyl)phenyl]quinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 144829254) has the molecular formula C25H21F4N5O and a molecular weight of 483.47 g/mol. Its IUPAC name is 2-[4-[8-fluoro-6-methyl-7-[2-(trifluoromethyl)phenyl]quinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-[8-fluoro-6-methyl-7-[2-(trifluoromethyl)phenyl]quinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 144829254 |
| Molecular Formula | C25H21F4N5O |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[4-[8-fluoro-6-methyl-7-[2-(trifluoromethyl)phenyl]quinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(F)c(-c4ccccc4C(F)(F)F)c(C)cc23)CC1CC#N |
| InChI | InChI=1S/C25H21F4N5O/c1-3-20(35)34-11-10-33(13-16(34)8-9-30)24-18-12-15(2)21(22(26)23(18)31-14-32-24)17-6-4-5-7-19(17)25(27,28)29/h3-7,12,14,16H,1,8,10-11,13H2,2H3 |
| InChIKey | UJJPOEZQXITBGM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|