C27H31FN6O — CID 155215308
1-[4-[7-[3-[(Z)-N-(dimethylamino)-C-methylcarbonimidoyl]-2-methylphenyl]-8-fluoro-6-methylquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 155215308) has the molecular formula C27H31FN6O and a molecular weight of 474.58 g/mol. Its IUPAC name is 1-[4-[7-[3-[(Z)-N-(dimethylamino)-C-methylcarbonimidoyl]-2-methylphenyl]-8-fluoro-6-methylquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-[3-[(Z)-N-(dimethylamino)-C-methylcarbonimidoyl]-2-methylphenyl]-8-fluoro-6-methylquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155215308 |
| Molecular Formula | C27H31FN6O |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 1-[4-[7-[3-[(Z)-N-(dimethylamino)-C-methylcarbonimidoyl]-2-methylphenyl]-8-fluoro-6-methylquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(F)c(-c4cccc(/C(C)=N\N(C)C)c4C)c(C)cc23)CC1 |
| InChI | InChI=1S/C27H31FN6O/c1-7-23(35)33-11-13-34(14-12-33)27-22-15-17(2)24(25(28)26(22)29-16-30-27)21-10-8-9-20(18(21)3)19(4)31-32(5)6/h7-10,15-16H,1,11-14H2,2-6H3/b31-19- |
| InChIKey | KMUYNEZMCXWSBF-DXJNIWACSA-N |
| XLogP | 4.17 |
| TPSA | 64.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|