About N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine
N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine (PubChem CID 144831942) has the molecular formula C8H12FN3O
and a molecular weight of 185.20 g/mol. Its IUPAC name is N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine.
Molecular Properties
| Compound Name | N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine |
| PubChem CID | 144831942 |
| Molecular Formula | C8H12FN3O |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine |
| SMILES | C=C(F)N(O)NC1=C(N)C=CCC1 |
| InChI | InChI=1S/C8H12FN3O/c1-6(9)12(13)11-8-5-3-2-4-7(8)10/h2,4,11,13H,1,3,5,10H2 |
| InChIKey | GTHJVJWZBHWESM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine?
The IUPAC name of N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine (CID 144831942) is N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine.
What is the SMILES notation for N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine?
The canonical SMILES for N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine is C=C(F)N(O)NC1=C(N)C=CCC1.
What is the InChIKey of N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine?
The InChIKey is GTHJVJWZBHWESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN3O/c1-6(9)12(13)11-8-5-3-2-4-7(8)10/h2,4,11,13H,1,3,5,10H2.
What are the key properties of N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine?
N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine has a molecular weight of 185.20 g/mol, XLogP of 1.14, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-aminocyclohexa-1,3-dien-1-yl)amino]-N-(1-fluoroethenyl)hydroxylamine is sourced from PubChem (CID 144831942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).