C6H9FN2 — CID 163668641
(6-fluorocyclohexa-1,3-dien-1-yl)hydrazine (PubChem CID 163668641) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is (6-fluorocyclohexa-1,3-dien-1-yl)hydrazine.
| Compound Name | (6-fluorocyclohexa-1,3-dien-1-yl)hydrazine |
|---|---|
| PubChem CID | 163668641 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (6-fluorocyclohexa-1,3-dien-1-yl)hydrazine |
| SMILES | NNC1=CC=CCC1F |
| InChI | InChI=1S/C6H9FN2/c7-5-3-1-2-4-6(5)9-8/h1-2,4-5,9H,3,8H2 |
| InChIKey | JAPQRRVOUNQVHR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|