C7H8ClFN2 — CID 143847287
(3-chloro-4-fluorocyclohepta-1,3,5-trien-1-yl)hydrazine (PubChem CID 143847287) has the molecular formula C7H8ClFN2 and a molecular weight of 174.61 g/mol. Its IUPAC name is (3-chloro-4-fluorocyclohepta-1,3,5-trien-1-yl)hydrazine.
| Compound Name | (3-chloro-4-fluorocyclohepta-1,3,5-trien-1-yl)hydrazine |
|---|---|
| PubChem CID | 143847287 |
| Molecular Formula | C7H8ClFN2 |
| Molecular Weight | 174.61 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | (3-chloro-4-fluorocyclohepta-1,3,5-trien-1-yl)hydrazine |
| SMILES | NNC1=CC(Cl)=C(F)C=CC1 |
| InChI | InChI=1S/C7H8ClFN2/c8-6-4-5(11-10)2-1-3-7(6)9/h1,3-4,11H,2,10H2 |
| InChIKey | VSSUFXXZWSVECX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.61 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|