C15H20N4O — CID 144832574
5-[(2Z)-2-ethenylpenta-2,4-dienyl]-2-piperazin-1-yl-1H-pyrimidin-6-one (PubChem CID 144832574) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-2-piperazin-1-yl-1H-pyrimidin-6-one.
| Compound Name | 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-2-piperazin-1-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 144832574 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-2-piperazin-1-yl-1H-pyrimidin-6-one |
| SMILES | C=C/C=C(\C=C)Cc1cnc(N2CCNCC2)[nH]c1=O |
| InChI | InChI=1S/C15H20N4O/c1-3-5-12(4-2)10-13-11-17-15(18-14(13)20)19-8-6-16-7-9-19/h3-5,11,16H,1-2,6-10H2,(H,17,18,20)/b12-5+ |
| InChIKey | RKKDPVMYDJWDHC-LFYBBSHMSA-N |
| XLogP | 1.02 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|