C16H22N4 — CID 144832591
5-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-methyl-2-piperazin-1-ylpyrimidine (PubChem CID 144832591) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-methyl-2-piperazin-1-ylpyrimidine.
| Compound Name | 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-methyl-2-piperazin-1-ylpyrimidine |
|---|---|
| PubChem CID | 144832591 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-4-methyl-2-piperazin-1-ylpyrimidine |
| SMILES | C=C/C=C(\C=C)Cc1cnc(N2CCNCC2)nc1C |
| InChI | InChI=1S/C16H22N4/c1-4-6-14(5-2)11-15-12-18-16(19-13(15)3)20-9-7-17-8-10-20/h4-6,12,17H,1-2,7-11H2,3H3/b14-6+ |
| InChIKey | YZZDOSBXQATWPM-MKMNVTDBSA-N |
| XLogP | 2.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|