C30H24ClFN6O3S — CID 144832912
[4-[[5-chloro-4-(1-phenylsulfanylindol-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-(2-fluoro-4-nitrophenyl)methanone (PubChem CID 144832912) has the molecular formula C30H24ClFN6O3S and a molecular weight of 603.08 g/mol. Its IUPAC name is [4-[[5-chloro-4-(1-phenylsulfanylindol-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-(2-fluoro-4-nitrophenyl)methanone.
| Compound Name | [4-[[5-chloro-4-(1-phenylsulfanylindol-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-(2-fluoro-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 144832912 |
| Molecular Formula | C30H24ClFN6O3S |
| Molecular Weight | 603.08 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | [4-[[5-chloro-4-(1-phenylsulfanylindol-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-(2-fluoro-4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1F)N1CCC(Nc2ncc(Cl)c(-c3cn(Sc4ccccc4)c4ccccc34)n2)CC1 |
| InChI | InChI=1S/C30H24ClFN6O3S/c31-25-17-33-30(34-19-12-14-36(15-13-19)29(39)23-11-10-20(38(40)41)16-26(23)32)35-28(25)24-18-37(27-9-5-4-8-22(24)27)42-21-6-2-1-3-7-21/h1-11,16-19H,12-15H2,(H,33,34,35) |
| InChIKey | KCZWNYZLCXENSC-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.08 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|