C35H45FN2O2 — CID 144835616
5-fluoro-2-[[4-(6-methylnon-1-en-2-yl)phenyl]methyl]-4-[(4R)-4-(2-oxobut-3-enimidoyl)cycloheptyl]benzamide (PubChem CID 144835616) has the molecular formula C35H45FN2O2 and a molecular weight of 544.76 g/mol. Its IUPAC name is 5-fluoro-2-[[4-(6-methylnon-1-en-2-yl)phenyl]methyl]-4-[(4R)-4-(2-oxobut-3-enimidoyl)cycloheptyl]benzamide.
| Compound Name | 5-fluoro-2-[[4-(6-methylnon-1-en-2-yl)phenyl]methyl]-4-[(4R)-4-(2-oxobut-3-enimidoyl)cycloheptyl]benzamide |
|---|---|
| PubChem CID | 144835616 |
| Molecular Formula | C35H45FN2O2 |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | 5-fluoro-2-[[4-(6-methylnon-1-en-2-yl)phenyl]methyl]-4-[(4R)-4-(2-oxobut-3-enimidoyl)cycloheptyl]benzamide |
| SMILES | [H]/N=C(\C(=O)C=C)[C@@H]1CCCC(c2cc(Cc3ccc(C(=C)CCCC(C)CCC)cc3)c(C(N)=O)cc2F)CC1 |
| InChI | InChI=1S/C35H45FN2O2/c1-5-9-23(3)10-7-11-24(4)26-16-14-25(15-17-26)20-29-21-30(32(36)22-31(29)35(38)40)27-12-8-13-28(19-18-27)34(37)33(39)6-2/h6,14-17,21-23,27-28,37H,2,4-5,7-13,18-20H2,1,3H3,(H2,38,40)/b37-34-/t23?,27?,28-/m1/s1 |
| InChIKey | QANLSTNDPUOIDU-GNHHOZRGSA-N |
| XLogP | 8.57 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|