C21H17N5O2 — CID 144835818
7-(cyclooctatetraenylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 144835818) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 7-(cyclooctatetraenylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 7-(cyclooctatetraenylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 144835818 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 7-(cyclooctatetraenylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(N)=O)cc2c(=O)n3ccccc3nc2n1CC1=C/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C21H17N5O2/c22-18-15(19(23)27)12-16-20(24-17-10-6-7-11-25(17)21(16)28)26(18)13-14-8-4-2-1-3-5-9-14/h1-12,22H,13H2,(H2,23,27)/b2-1-,3-1-,4-2-,5-3-,8-4-,9-5-,14-8+,14-9+,22-18+ |
| InChIKey | NSMPNMPNOAHGGC-BBALLOABSA-N |
| XLogP | 1.84 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|