C23H19N5O2 — CID 166798239
7-(cyclodecapentaenylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 166798239) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 7-(cyclodecapentaenylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 7-(cyclodecapentaenylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 166798239 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 7-(cyclodecapentaenylmethyl)-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(N)=O)cc2c(=O)n3ccccc3nc2n1Cc1ccccccccc1 |
| InChI | InChI=1S/C23H19N5O2/c24-20-17(21(25)29)14-18-22(26-19-12-8-9-13-27(19)23(18)30)28(20)15-16-10-6-4-2-1-3-5-7-11-16/h1-14,24H,15H2,(H2,25,29)/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,10-6+,11-7-,16-10+,16-11+,24-20+ |
| InChIKey | RLHPBIVZKXKPLX-NQMZSZOSSA-N |
| XLogP | 2.40 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|