C16H33NU — CID 144835868
6-butan-2-yl-1,3,3,5,5-pentamethylazocane;uranium (PubChem CID 144835868) has the molecular formula C16H33NU and a molecular weight of 477.48 g/mol. Its IUPAC name is 6-butan-2-yl-1,3,3,5,5-pentamethylazocane;uranium.
| Compound Name | 6-butan-2-yl-1,3,3,5,5-pentamethylazocane;uranium |
|---|---|
| PubChem CID | 144835868 |
| Molecular Formula | C16H33NU |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 6-butan-2-yl-1,3,3,5,5-pentamethylazocane;uranium |
| SMILES | CCC(C)C1CCN(C)CC(C)(C)CC1(C)C.[U] |
| InChI | InChI=1S/C16H33N.U/c1-8-13(2)14-9-10-17(7)12-15(3,4)11-16(14,5)6;/h13-14H,8-12H2,1-7H3; |
| InChIKey | QAXHABPOVOIHMF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |