About 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine
4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine (PubChem CID 176568410) has the molecular formula C24H46F4N2O2
and a molecular weight of 470.64 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine |
| PubChem CID | 176568410 |
| Molecular Formula | C24H46F4N2O2 |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.35 |
| IUPAC Name | 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine |
| SMILES | CC(C)OCC1(C)CN(C)CCC1C(F)F.CC(C)OCC1(C)CN(C)CCC1C(F)F |
| InChI | InChI=1S/2C12H23F2NO/c2*1-9(2)16-8-12(3)7-15(4)6-5-10(12)11(13)14/h2*9-11H,5-8H2,1-4H3 |
| InChIKey | CKVUYKQRFFNHLU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine?
The IUPAC name of 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine (CID 176568410) is 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine.
What is the SMILES notation for 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine?
The canonical SMILES for 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine is CC(C)OCC1(C)CN(C)CCC1C(F)F.CC(C)OCC1(C)CN(C)CCC1C(F)F.
What is the InChIKey of 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine?
The InChIKey is CKVUYKQRFFNHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H23F2NO/c2*1-9(2)16-8-12(3)7-15(4)6-5-10(12)11(13)14/h2*9-11H,5-8H2,1-4H3.
What are the key properties of 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine?
4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine has a molecular weight of 470.64 g/mol, XLogP of 5.27, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-1,3-dimethyl-3-(propan-2-yloxymethyl)piperidine is sourced from PubChem (CID 176568410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).