C27H31N5O3S — CID 144835934
N-[4-(dimethylcarbamoylamino)phenyl]-N-methyl-2-[(2-methylphenyl)sulfanylcarbamoylamino]-3-phenylpropanamide (PubChem CID 144835934) has the molecular formula C27H31N5O3S and a molecular weight of 505.64 g/mol. Its IUPAC name is N-[4-(dimethylcarbamoylamino)phenyl]-N-methyl-2-[(2-methylphenyl)sulfanylcarbamoylamino]-3-phenylpropanamide.
| Compound Name | N-[4-(dimethylcarbamoylamino)phenyl]-N-methyl-2-[(2-methylphenyl)sulfanylcarbamoylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 144835934 |
| Molecular Formula | C27H31N5O3S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[4-(dimethylcarbamoylamino)phenyl]-N-methyl-2-[(2-methylphenyl)sulfanylcarbamoylamino]-3-phenylpropanamide |
| SMILES | Cc1ccccc1SNC(=O)NC(Cc1ccccc1)C(=O)N(C)c1ccc(NC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C27H31N5O3S/c1-19-10-8-9-13-24(19)36-30-26(34)29-23(18-20-11-6-5-7-12-20)25(33)32(4)22-16-14-21(15-17-22)28-27(35)31(2)3/h5-17,23H,18H2,1-4H3,(H,28,35)(H2,29,30,34) |
| InChIKey | HQEKJWRFAAHBDI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|