C23H22ClN3O3S — CID 144836008
2-(benzenesulfinylcarbamoylamino)-N-(4-chlorophenyl)-N-methyl-3-phenylpropanamide (PubChem CID 144836008) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is 2-(benzenesulfinylcarbamoylamino)-N-(4-chlorophenyl)-N-methyl-3-phenylpropanamide.
| Compound Name | 2-(benzenesulfinylcarbamoylamino)-N-(4-chlorophenyl)-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 144836008 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-(benzenesulfinylcarbamoylamino)-N-(4-chlorophenyl)-N-methyl-3-phenylpropanamide |
| SMILES | CN(C(=O)C(Cc1ccccc1)NC(=O)NS(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-27(19-14-12-18(24)13-15-19)22(28)21(16-17-8-4-2-5-9-17)25-23(29)26-31(30)20-10-6-3-7-11-20/h2-15,21H,16H2,1H3,(H2,25,26,29) |
| InChIKey | CJQQPVHIYXRGMX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |