C7H8FNO2 — CID 144836160
(2E)-3-amino-2-(1-fluoroethenyl)penta-2,4-dienoic acid (PubChem CID 144836160) has the molecular formula C7H8FNO2 and a molecular weight of 157.14 g/mol. Its IUPAC name is (2E)-3-amino-2-(1-fluoroethenyl)penta-2,4-dienoic acid.
| Compound Name | (2E)-3-amino-2-(1-fluoroethenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 144836160 |
| Molecular Formula | C7H8FNO2 |
| Molecular Weight | 157.14 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | (2E)-3-amino-2-(1-fluoroethenyl)penta-2,4-dienoic acid |
| SMILES | C=C/C(N)=C(\C(=C)F)C(=O)O |
| InChI | InChI=1S/C7H8FNO2/c1-3-5(9)6(4(2)8)7(10)11/h3H,1-2,9H2,(H,10,11)/b6-5- |
| InChIKey | BWDNFAQAXKHWRN-WAYWQWQTSA-N |
| XLogP | 0.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.14 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|