C15H17F3N4O2 — CID 144838244
formohydrazide;1-[2-[(E)-2-(furan-2-yl)ethenyl]-3-(trifluoromethyl)phenyl]-1-methylhydrazine (PubChem CID 144838244) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is formohydrazide;1-[2-[(E)-2-(furan-2-yl)ethenyl]-3-(trifluoromethyl)phenyl]-1-methylhydrazine.
| Compound Name | formohydrazide;1-[2-[(E)-2-(furan-2-yl)ethenyl]-3-(trifluoromethyl)phenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 144838244 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | formohydrazide;1-[2-[(E)-2-(furan-2-yl)ethenyl]-3-(trifluoromethyl)phenyl]-1-methylhydrazine |
| SMILES | CN(N)c1cccc(C(F)(F)F)c1/C=C/c1ccco1.NNC=O |
| InChI | InChI=1S/C14H13F3N2O.CH4N2O/c1-19(18)13-6-2-5-12(14(15,16)17)11(13)8-7-10-4-3-9-20-10;2-3-1-4/h2-9H,18H2,1H3;1H,2H2,(H,3,4)/b8-7+; |
| InChIKey | CNWPQCCCAJPULL-USRGLUTNSA-N |
| XLogP | 2.38 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|