C15H16FN3O2S — CID 144838468
1-amino-3-[3-cyclopropyl-5-fluoro-2-(furan-2-ylmethylsulfanyl)phenyl]urea (PubChem CID 144838468) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-amino-3-[3-cyclopropyl-5-fluoro-2-(furan-2-ylmethylsulfanyl)phenyl]urea.
| Compound Name | 1-amino-3-[3-cyclopropyl-5-fluoro-2-(furan-2-ylmethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 144838468 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-amino-3-[3-cyclopropyl-5-fluoro-2-(furan-2-ylmethylsulfanyl)phenyl]urea |
| SMILES | NNC(=O)Nc1cc(F)cc(C2CC2)c1SCc1ccco1 |
| InChI | InChI=1S/C15H16FN3O2S/c16-10-6-12(9-3-4-9)14(13(7-10)18-15(20)19-17)22-8-11-2-1-5-21-11/h1-2,5-7,9H,3-4,8,17H2,(H2,18,19,20) |
| InChIKey | QBHGUCNUQALGME-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|