About methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate
methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate (PubChem CID 144840477) has the molecular formula C21H22FN3O4
and a molecular weight of 399.42 g/mol. Its IUPAC name is methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate |
| PubChem CID | 144840477 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(-c2nc(C3=C(C)CC4(CC3)OCCO4)cnc2N)cc1F |
| InChI | InChI=1S/C21H22FN3O4/c1-12-10-21(28-7-8-29-21)6-5-14(12)17-11-24-19(23)18(25-17)13-3-4-15(16(22)9-13)20(26)27-2/h3-4,9,11H,5-8,10H2,1-2H3,(H2,23,24) |
| InChIKey | DWBBYNUTBISWLG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate?
The IUPAC name of methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate (CID 144840477) is methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate.
What is the SMILES notation for methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate?
The canonical SMILES for methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate is COC(=O)c1ccc(-c2nc(C3=C(C)CC4(CC3)OCCO4)cnc2N)cc1F.
What is the InChIKey of methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate?
The InChIKey is DWBBYNUTBISWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O4/c1-12-10-21(28-7-8-29-21)6-5-14(12)17-11-24-19(23)18(25-17)13-3-4-15(16(22)9-13)20(26)27-2/h3-4,9,11H,5-8,10H2,1-2H3,(H2,23,24).
What are the key properties of methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate?
methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate has a molecular weight of 399.42 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-amino-6-(7-methyl-1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrazin-2-yl]-2-fluorobenzoate is sourced from PubChem (CID 144840477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).