C9H17N5O — CID 144842058
1-[(E)-2,3-bis(methylamino)prop-2-enimidoyl]-3-methylimidazolidin-2-one (PubChem CID 144842058) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 1-[(E)-2,3-bis(methylamino)prop-2-enimidoyl]-3-methylimidazolidin-2-one.
| Compound Name | 1-[(E)-2,3-bis(methylamino)prop-2-enimidoyl]-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 144842058 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-[(E)-2,3-bis(methylamino)prop-2-enimidoyl]-3-methylimidazolidin-2-one |
| SMILES | [H]/N=C(C(=C/NC)\NC)/N1CCN(C)C1=O |
| InChI | InChI=1S/C9H17N5O/c1-11-6-7(12-2)8(10)14-5-4-13(3)9(14)15/h6,10-12H,4-5H2,1-3H3/b7-6+,10-8+ |
| InChIKey | HVHPWMOLLHKXOR-LQPGMRSMSA-N |
| XLogP | -0.39 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|